CAS 22347-29-1

1-(4-bromophenyl)-1,2-dihydro-5H-tetrazole-5-thione

Description:

1-(4-bromophenyl)-1,2-dihydro-5H-tetrazole-5-thione, with the CAS number 22347-29-1, is a heterocyclic compound characterized by the presence of a tetrazole ring, which is a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which contributes to its chemical reactivity and potential applications in various fields. The thione functional group (–S=) indicates that it contains a sulfur atom double-bonded to a carbon atom, which can influence its chemical behavior, particularly in nucleophilic reactions. The compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and the ability to participate in various chemical reactions. Its unique structure may lend itself to applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its biological activity and reactivity.

Formula: C₇H₅BrN₄S

InChI: InChI=1/C7H5BrN4S/c8-5-1-3-6(4-2-5)12-7(13)9-10-11-12/h1-4H,(H,9,11,13)

SMILES: c1cc(ccc1Br)n1c(nnn1)S

Synonyms:

• 1-(4-Bromophenyl)-1H-tetrazole-5-thiol
• 1H-tetrazole-5-thiol, 1-(4-bromophenyl)-

1-(4-bromophenyl)-5-mercapto-1,2,3,4-tetrazole

CAS: 22347-29-1

Formula: C₇H₅BrN₄S

Purity: 95%

Molecular weight: 257.1104

Ref: IN-DA00BNU6

1-(4-Bromophenyl)-4,5-dihydro-1H-1,2,3,4-tetrazole-5-thione

CAS: 22347-29-1

1-(4-Bromophenyl)-4,5-dihydro-1H-1,2,3,4-tetrazole-5-thione (BPHT) is a potent thyroid hormone antagonist that inhibits the synthesis of thyroxine by binding to the thyroxine receptor. It has been shown to be effective in animals and humans with hypothyroidism. BPHT has also been shown to inhibit adenosine deaminase and cyclic adenosine monophosphate (cAMP) levels in certain cell types. BPHT has also been shown to have a weak effect on the liver enzymes alanine aminotransferase and aspartate aminotransferase.

Formula: C₇H₅BrN₄S

Purity: Min. 95%

Molecular weight: 257.11 g/mol

Ref: 3D-XAA34729