CAS 223487-53-4

Butane-1,1,1,2,2,3,3-d7, 4-bromo-

Description:

Butane-1,1,1,2,2,3,3-d7, 4-bromo- is a deuterated derivative of butane, specifically featuring bromine substitution at the fourth carbon. The presence of deuterium, a stable isotope of hydrogen, replaces several hydrogen atoms in the butane structure, which can influence its physical and chemical properties, such as boiling point and reactivity. The bromine atom introduces a halogen functional group, which can enhance the compound's reactivity, particularly in nucleophilic substitution reactions. This compound is likely to be a colorless liquid at room temperature, with a characteristic odor associated with aliphatic hydrocarbons. Its deuterated nature makes it useful in various applications, including studies in isotope labeling and tracing in chemical reactions. Additionally, the presence of bromine may allow for further functionalization or reactions typical of alkyl halides. Safety precautions should be observed when handling this compound, as brominated compounds can be hazardous.

Formula: C₄H₂BrD₇

InChI: InChI=1S/C4H9Br/c1-2-3-4-5/h2-4H2,1H3/i1D3,2D2,3D2

InChI key: InChIKey=MPPPKRYCTPRNTB-NCKGIQLSSA-N

SMILES: C(CBr)(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H]

Synonyms:

• 1-Bromobutane-2,2,3,3,4,4,4-d7
• Butane-1,1,1,2,2,3,3-d7, 4-bromo-

1-Bromobutane-2,2,3,3,4,4,4-d7

CAS: 223487-53-4

Formula: CD₃CD₂CD₂CH₂Br

Purity: 98 atom % D

Color and Shape: Colorless-Pale Yellow Liquid

Molecular weight: 143.0327

Ref: 3U-D6881

1-Bromobutane-2,2,3,3,4,4,4-d7

Controlled Product

CAS: 223487-53-4

Applications 1-Bromobutane-2,2,3,3,4,4,4-d7 (CAS# 223487-53-4) is a useful isotopically labeled research compound.

Formula: C₄H₂D₇Br

Color and Shape: Neat

Molecular weight: 144.06

Ref: TR-B681841