CAS 223519-08-2
:methyl 3-bromo-4-methyl-5-nitro-benzoate
Description:
Methyl 3-bromo-4-methyl-5-nitrobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with various functional groups. The presence of a bromine atom, a nitro group, and a methyl ester contributes to its reactivity and potential applications in organic synthesis. The bromine atom typically enhances electrophilic substitution reactions, while the nitro group can serve as a strong electron-withdrawing group, influencing the compound's reactivity and stability. The methyl ester functional group indicates that this compound is a methyl ester of benzoic acid, which can participate in esterification and hydrolysis reactions. This compound may be used in the synthesis of more complex organic molecules, and its unique substituents can impart specific properties, such as solubility and polarity. Additionally, the presence of the nitro group may confer biological activity, making it of interest in medicinal chemistry. Overall, methyl 3-bromo-4-methyl-5-nitrobenzoate is a versatile compound with significant implications in chemical research and synthesis.
Formula:C9H8BrNO4
InChI:InChI=1/C9H8BrNO4/c1-5-7(10)3-6(9(12)15-2)4-8(5)11(13)14/h3-4H,1-2H3
SMILES:Cc1c(cc(cc1N(=O)=O)C(=O)OC)Br
Synonyms:- 3-Bromo-4-mehtyl-5-nitrobenzoic acid methyl ester
- 3-Bromo-4-methyl-5-nitrobenzoic acid methyl ester
- 3-Bromo-5-nitro-p-toluic acid methyl ester
- Benzoic Acid, 3-Bromo-4-Methyl-5-Nitro-, Methyl Ester
- Methyl 3-bromo-4-methyl-5-nitrobenzoate
- Methyl 3-bromo-5-nitro-p-toluate
- Wnr Ce B1 Evo1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-4-methyl-5-nitrobenzoic acid methyl ester
CAS:Formula:C9H8BrNO4Purity:97%Color and Shape:SolidMolecular weight:274.06813-Bromo-4-methyl-5-nitro-benzoic acid methyl ester
CAS:<p>3-Bromo-4-methyl-5-nitro-benzoic acid methyl ester</p>Purity:97%Molecular weight:274.07g/mol3-Bromo-4-methyl-5-nitro-benzoic acid methyl ester
CAS:Formula:C9H8BrNO4Purity:95%Color and Shape:SolidMolecular weight:274.07methyl 3-bromo-4-methyl-5-nitrobenzoate
CAS:<p>Versatile small molecule scaffold</p>Formula:C9H8BrNO4Purity:Min. 95%Molecular weight:274.07 g/mol



