CAS 22353-43-1

3-chloro-2-hydrazino-5-nitropyridine

Description:

3-Chloro-2-hydrazino-5-nitropyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 3-position and a nitro group at the 5-position contributes to its reactivity and potential applications in various chemical syntheses. The hydrazino group at the 2-position introduces a functional group that can participate in further chemical reactions, making it a versatile intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its chemical properties are influenced by the electron-withdrawing effects of the nitro and chloro substituents, which can affect its acidity and nucleophilicity. Additionally, due to the presence of the hydrazino group, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive functional groups.

Formula: C₅H₅ClN₄O₂

InChI: InChI=1/C5H5ClN4O2/c6-4-1-3(10(11)12)2-8-5(4)9-7/h1-2H,7H2,(H,8,9)

SMILES: c1c(cnc(c1Cl)NN)N(=O)=O

Synonyms:

• Pyridine, 3-Chloro-2-Hydrazinyl-5-Nitro-

3-Chloro-2-hydrazinyl-5-nitropyridine

CAS: 22353-43-1

Formula: C₅H₅ClN₄O₂

Molecular weight: 188.5718

Ref: IN-DA00C479

3-Chloro-2-hydrazino-5-nitropyridine

CAS: 22353-43-1

3-Chloro-2-hydrazino-5-nitropyridine

Purity: ≥95%

Molecular weight: 188.57g/mol

Ref: 54-OR345301