CAS 22353-82-8

5-chlorothiophene-2-carboxamide

Description:

5-Chlorothiophene-2-carboxamide is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a chlorine atom at the 5-position and a carboxamide functional group at the 2-position contributes to its chemical reactivity and potential applications. This compound typically exhibits moderate solubility in polar organic solvents due to the polar nature of the carboxamide group. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. The compound's unique structure allows it to interact with biological systems, which may lead to potential pharmaceutical applications. Additionally, its properties can be influenced by factors such as temperature and pH, which can affect its stability and reactivity. Overall, 5-chlorothiophene-2-carboxamide is a versatile compound with significant implications in both chemical research and potential industrial applications.

Formula: C₅H₄ClNOS

InChI: InChI=1/C5H4ClNOS/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H2,7,8)

SMILES: c1cc(Cl)sc1C(=O)N

Synonyms:

• 2-Thiophenecarboxamide, 5-Chloro-

5-Chlorothiophene-2-carboxamide

CAS: 22353-82-8

Formula: C₅H₄ClNOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.6094

Ref: IN-DA006YQE

5-Chlorothiophene-2-carboxamide

CAS: 22353-82-8

5-Chlorothiophene-2-carboxamide

Purity: 98%

Molecular weight: 161.61g/mol

Ref: 54-OR93039

5-Chlorothiophene-2-carboxamide

CAS: 22353-82-8

Purity: 98%

Molecular weight: 161.6000061

Ref: 10-F695129

5-Chloro-2-thiophenecarboxamide

Controlled Product

CAS: 22353-82-8

Applications 5-Chloro-2-thiophenecarboxamide is a metabolite of Rivaroxaban (R538000) which is a novel antithrombotic agent. Rivaroxaban is also a highly potent and selective, direct FXa inhibitor.
References Ansell, J., et al.: Drugs, 64, 1 (2004), Eriksson, B., et al.: J. Thromb. Haemost., 3, 103 (2005), Kubitza, D., et al.: Clin. Pharmacol. Ther., 78, 412 (2005)

Formula: C₅H₄ClNOS

Color and Shape: Neat

Molecular weight: 161.6

Ref: TR-C420510