CAS 223564-75-8

1-bromo-3-(2-methylpropoxy)benzene

Description:

1-Bromo-3-(2-methylpropoxy)benzene, with the CAS number 223564-75-8, is an organic compound characterized by the presence of a bromine atom and a 2-methylpropoxy group attached to a benzene ring. This compound features a bromine substituent at the meta position relative to the ether functional group, which can influence its reactivity and physical properties. Typically, such compounds exhibit moderate to low solubility in water due to their hydrophobic aromatic structure, while being more soluble in organic solvents. The presence of the bromine atom can enhance the compound's reactivity in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the branched alkyl group (2-methylpropoxy) can affect the steric hindrance and electronic properties of the molecule, potentially influencing its behavior in chemical reactions. Overall, 1-bromo-3-(2-methylpropoxy)benzene is of interest in various applications, including pharmaceuticals and materials science, due to its unique structural features.

Formula: C₁₀H₁₃BrO

InChI: InChI=1/C10H13BrO/c1-8(2)7-12-10-5-3-4-9(11)6-10/h3-6,8H,7H2,1-2H3

SMILES: CC(C)COc1cccc(c1)Br

Synonyms:

• 1-Bromo-3-isobutoxybenzene
• 3-Bromophenyl isobutyl ether
• Benzene, 1-Bromo-3-(2-Methylpropoxy)-

1-Bromo-3-(2-methylpropoxy)benzene

CAS: 223564-75-8

Formula: C₁₀H₁₃BrO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 229.1136

Ref: IN-DA00I4EN

1-Bromo-3-isobutoxybenzene

CAS: 223564-75-8

1-Bromo-3-isobutoxybenzene

Purity: 98%

Molecular weight: 229.12g/mol

Ref: 54-OR1060075

1-Bromo-3-(2-methylpropoxy)benzene

CAS: 223564-75-8

Purity: 98%

Molecular weight: 229.1170044

Ref: 10-F637067