CAS 223575-76-6

2'-chlorobiphenyl-2-carbaldehyde

Description:

2'-Chlorobiphenyl-2-carbaldehyde, identified by its CAS number 223575-76-6, is an organic compound characterized by the presence of a chlorobiphenyl structure with an aldehyde functional group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with a chlorine atom substituted at the 2' position of one of the rings. The aldehyde group (-CHO) is located at the 2-position of the biphenyl structure, contributing to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity, making it useful in various chemical reactions, including electrophilic substitutions. Additionally, compounds like 2'-chlorobiphenyl-2-carbaldehyde may exhibit biological activity, which can be of interest in pharmaceutical research. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated organic compounds.

Formula: C₁₃H₉ClO

InChI: InChI=1/C13H9ClO/c14-13-8-4-3-7-12(13)11-6-2-1-5-10(11)9-15/h1-9H

SMILES: c1ccc(c(c1)C=O)c1ccccc1Cl

2'-Chloro-biphenyl-2-carbaldehyde

CAS: 223575-76-6

Formula: C₁₃H₉ClO

Purity: 97%

Molecular weight: 216.6630

Ref: IN-DA006YQ4

2'-Chloro-[1,1'-biphenyl]-2-carboxaldehyde

CAS: 223575-76-6

2'-Chloro-[1,1'-biphenyl]-2-carboxaldehyde

Formula: C₁₃H₉ClO

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 216.66g/mol

Ref: 54-OR7344

2′-Chloro-[1,1′-biphenyl]-2-carbaldehyde

CAS: 223575-76-6

Purity: 97%

Molecular weight: 216.6600037

Ref: 10-F640292

2'-Chloro[1,1'-biphenyl]-2-carbaldehyde

CAS: 223575-76-6

Versatile small molecule scaffold

Formula: C₁₃H₉ClO

Purity: Min. 95%

Molecular weight: 216.66 g/mol

Ref: 3D-YIA57576