CAS 223575-93-7

3'-(trifluoromethyl)biphenyl-2-carbaldehyde

Description:

3'-(Trifluoromethyl)biphenyl-2-carbaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a trifluoromethyl group (-CF3) at the 3' position significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and interactions in various chemical environments. The aldehyde functional group (-CHO) at the 2-position contributes to its reactivity, making it susceptible to nucleophilic attacks and oxidation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique electronic properties, imparted by the trifluoromethyl group, can also affect its spectral characteristics, making it useful in analytical chemistry. Additionally, the compound's stability and solubility in organic solvents are important for its applications in research and industry. Overall, 3'-(trifluoromethyl)biphenyl-2-carbaldehyde is a versatile compound with significant implications in various chemical fields.

Formula: C₁₄H₉F₃O

InChI: InChI=1/C14H9F3O/c15-14(16,17)12-6-3-5-10(8-12)13-7-2-1-4-11(13)9-18/h1-9H

SMILES: c1ccc(c2cccc(c2)C(F)(F)F)c(c1)C=O

Synonyms:

• [1,1'-Biphenyl]-2-carboxaldehyde, 3'-(trifluoromethyl)-
• 3'-(Trifluoromethyl)-1,1'-Biphenyl-2-Carbaldehyde

3'-(Trifluoromethyl)[1,1'-biphenyl]-2-carboxaldehyde

CAS: 223575-93-7

3'-(Trifluoromethyl)[1,1'-biphenyl]-2-carboxaldehyde

Purity: 95%

Molecular weight: 250.22g/mol

Ref: 54-PC11170

3′-Trifluoromethylbiphenyl-2-carbaldehyde

CAS: 223575-93-7

Formula: C₁₄H₉F₃O

Purity: ≥96%

Color and Shape: Liquid

Molecular weight: 250.22

Ref: 10-F014313