CAS 22364-25-6

4-bromo-2,3-dimethylaniline

Description:

4-Bromo-2,3-dimethylaniline is an organic compound characterized by its aromatic amine structure, which includes a bromine substituent and two methyl groups on the benzene ring. The presence of the bromine atom at the para position relative to the amino group, along with the dimethyl groups at the ortho positions, influences its chemical reactivity and physical properties. This compound typically appears as a solid or liquid, depending on the temperature, and is known for its moderate solubility in organic solvents. It exhibits basic properties due to the amino group, which can participate in hydrogen bonding and nucleophilic reactions. Additionally, 4-bromo-2,3-dimethylaniline can be involved in various synthetic applications, including the production of dyes, pharmaceuticals, and agrochemicals. Safety considerations are important, as it may pose health risks if inhaled or ingested, and appropriate handling procedures should be followed. Overall, its unique structure and properties make it a valuable compound in organic synthesis and industrial applications.

Formula: C₈H₁₀BrN

InChI: InChI=1/C8H10BrN/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,10H2,1-2H3

SMILES: Cc1c(C)c(ccc1Br)N

Synonyms:

• Benzenamine, 4-bromo-2,3-dimethyl-
• 4-Bromo-2,3-dimethylaniline

4-Bromo-2,3-dimethylaniline

CAS: 22364-25-6

Formula: C₈H₁₀BrN

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.0757

Ref: IN-DA007OOV

4-Bromo-2,3-dimethylaniline

CAS: 22364-25-6

Formula: C₈H₁₀BrN

Purity: 96%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 200.079

Ref: 10-F037718