CAS 22367-82-4

ethyl 3-methyl-1-benzofuran-2-carboxylate

Description:

Ethyl 3-methyl-1-benzofuran-2-carboxylate is an organic compound characterized by its unique structure, which includes a benzofuran moiety and an ester functional group. This compound features a carboxylate group that contributes to its reactivity and solubility properties. Typically, it appears as a colorless to pale yellow liquid with a pleasant odor. Ethyl 3-methyl-1-benzofuran-2-carboxylate is known for its potential applications in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to undergo further chemical transformations. The presence of the methyl group on the benzofuran ring can influence its biological activity and interaction with other molecules. Additionally, this compound may exhibit moderate to low toxicity, necessitating careful handling and storage. Its solubility in organic solvents makes it suitable for various chemical reactions and formulations. As with many organic compounds, its stability can be affected by environmental factors such as light and temperature, which should be considered during storage and use.

Formula: C₁₂H₁₂O₃

InChI: InChI=1/C12H12O3/c1-3-14-12(13)11-8(2)9-6-4-5-7-10(9)15-11/h4-7H,3H2,1-2H3

SMILES: CCOC(=O)c1c(C)c2ccccc2o1

Synonyms:

• 2-Benzofurancarboxylic acid, 3-methyl-, ethyl ester

3-Methylbenzofuran-2-Carboxylic Acid Ethyl Ester

CAS: 22367-82-4

Formula: C₁₂H₁₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 204.2219

Ref: IN-DA00BBU1

Ethyl 3-Methylbenzofuran-2-Carboxylate

CAS: 22367-82-4

Ethyl 3-Methylbenzofuran-2-Carboxylate

Purity: 97%

Molecular weight: 204.22g/mol

Ref: 54-OR1013186

3-Methylbenzofuran-2-carboxylic acid ethyl ester

CAS: 22367-82-4

Formula: C₁₂H₁₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 204.225

Ref: 10-F013632

3-Methylbenzofuran-2-carboxylic acid ethyl ester

CAS: 22367-82-4

3-Methylbenzofuran-2-carboxylic acid ethyl ester (MBFE) is a modulator that inhibits the activity of the mcf-7 protein, which is involved in metabolic disorders. MBFE also has activating effects on insulin sensitivity and carbonic anhydrase. This compound has been shown to inhibit the growth of cancer cells in culture, as well as reduce cholesterol levels when administered orally. MBFE may also be used to introduce a mitochondrial biogenesis factor into cancer cells, preventing tumor formation.

Formula: C₁₂H₁₂O₃

Purity: Min. 95%

Molecular weight: 204.22 g/mol

Ref: 3D-XAA36782