CAS 223671-15-6
:7-Bromo-1-hydroxyisoquinoline
Description:
7-Bromo-1-hydroxyisoquinoline is a chemical compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring system. The presence of a bromine atom at the 7-position and a hydroxyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest that it may participate in hydrogen bonding and other intermolecular interactions, making it of interest in medicinal chemistry and organic synthesis. The bromine substituent can also enhance the compound's electrophilic character, potentially influencing its reactivity in various chemical reactions. Additionally, compounds of this class are often studied for their pharmacological properties, including antimicrobial and anticancer activities. As with many chemical substances, safety precautions should be observed when handling 7-Bromo-1-hydroxyisoquinoline due to potential toxicity or reactivity.
Formula:C9H6BrNO
InChI:InChI=1/C9H6BrNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-5H,(H,11,12)
SMILES:c1cc(cc2c1ccnc2O)Br
Synonyms:- 7-Bromoisocarbostyril
- 7-bromoisoquinolin-1(2H)-one
- 7-bromo-1(2H)-isoquinolone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Bromo-1-hydroxyisoquinoline, 97%
CAS:<p>7-Bromo-1-hydroxyisoquinoline acts as a pharmaceutical intermediate. It is also used to prepare 1-amino-4-bromoisoquinoline. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand.</p>Formula:C9H6BrNOPurity:97%Color and Shape:Pale cream to yellow to brown, PowderMolecular weight:224.067-Bromo-1-hydroxyisoquinoline
CAS:<p>7-Bromo-1-hydroxyisoquinoline</p>Formula:C9H6BrNOPurity:98%Color and Shape: off-white to light yellow solidMolecular weight:224.05g/mol7-Bromo-4-hydroxyisoquinoline
CAS:Formula:C9H6BrNOPurity:98%Color and Shape:SolidMolecular weight:224.057
