CAS 223671-15-6: 7-Bromo-1-hydroxyisoquinoline

Description:7-Bromo-1-hydroxyisoquinoline is a chemical compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring system. The presence of a bromine atom at the 7-position and a hydroxyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest that it may participate in hydrogen bonding and other intermolecular interactions, making it of interest in medicinal chemistry and organic synthesis. The bromine substituent can also enhance the compound's electrophilic character, potentially influencing its reactivity in various chemical reactions. Additionally, compounds of this class are often studied for their pharmacological properties, including antimicrobial and anticancer activities. As with many chemical substances, safety precautions should be observed when handling 7-Bromo-1-hydroxyisoquinoline due to potential toxicity or reactivity.

Formula:C₉H₆BrNO

InChI:InChI=1/C9H6BrNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-5H,(H,11,12)

Synonyms:
7-Bromoisocarbostyril
7-bromoisoquinolin-1(2H)-one
7-bromo-1(2H)-isoquinolone

Found 4 products.

Product data	Purity	Price range	Estimated delivery
7-Bromo-1-hydroxyisoquinoline, 97% REF: 02-L17800CAS: 223671-15-6	97%	To inquire	Wed 06 Aug 25
7-Bromoisoquinolin-1-ol REF: IN-DA003NDXCAS: 223671-15-6	96%	To inquire	Tue 12 Aug 25
7-Bromo-1-hydroxyisoquinoline REF: 54-OR300047CAS: 223671-15-6	98+%	32.00 €~1,497.00 €	Wed 13 Aug 25
7-Bromo-1-hydroxyisoquinoline REF: 3D-FB142802CAS: 223671-15-6	Min. 95%	- - -	Discontinued product