CAS 223671-81-6

4-Chloro-1,2-dihydro-1-oxo-7-isoquinolinesulfonyl chloride

Description:

4-Chloro-1,2-dihydro-1-oxo-7-isoquinolinesulfonyl chloride is a chemical compound characterized by its unique structure, which includes an isoquinoline moiety and a sulfonyl chloride functional group. This compound typically appears as a solid at room temperature and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The chlorine atom in the 4-position of the isoquinoline ring contributes to its electrophilic nature, making it a potential intermediate in organic synthesis. The compound may exhibit biological activity, which is often explored in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility can vary depending on the solvent, and it is generally handled with care due to the potential hazards associated with sulfonyl chlorides, including their corrosive nature and ability to release hydrochloric acid upon hydrolysis. Proper safety measures should be taken when working with this compound in laboratory settings.

Formula: C₉H₅Cl₂NO₃S

InChI: InChI=1S/C9H5Cl2NO3S/c10-8-4-12-9(13)7-3-5(16(11,14)15)1-2-6(7)8/h1-4H,(H,12,13)

InChI key: InChIKey=BKJUCAQGGKWKRQ-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC=C(S(Cl)(=O)=O)C2)C(Cl)=CN1

Synonyms:

• 7-Isoquinolinesulfonyl chloride, 4-chloro-1,2-dihydro-1-oxo-
• 4-Chloro-1,2-dihydro-1-oxo-7-isoquinolinesulfonyl chloride

4-Chloro-1-hydroxy-7-isoquinolinesulfonyl Chloride

Controlled Product

CAS: 223671-81-6

Applications 4-Chloro-1-hydroxy-7-isoquinolinesulfonyl Chloride (cas# 223671-81-6) is a compound useful in organic synthesis.

Formula: C₉H₅Cl₂NO₃S

Color and Shape: Neat

Molecular weight: 278.11

Ref: TR-C366620