CAS 223671-94-1

[7-(3-Carboxyphenyl)-4-chloroisoquinolin-1-yl)]guanidine

Description:

[7-(3-Carboxyphenyl)-4-chloroisoquinolin-1-yl)]guanidine, with the CAS number 223671-94-1, is a chemical compound characterized by its complex structure, which includes an isoquinoline moiety substituted with a carboxyphenyl group and a guanidine functional group. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of the carboxylic acid group. The chloro substituent can impart unique reactivity, potentially allowing for further chemical modifications. The guanidine group is known for its basicity and ability to form hydrogen bonds, which may enhance its interaction with biological targets. Such compounds are often studied for their potential pharmacological activities, including antimicrobial or anticancer properties, due to their ability to interact with various biological pathways. The presence of multiple functional groups suggests that it may participate in diverse chemical reactions, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₇H₁₃ClN₄O₂

InChI: InChI=1S/C17H13ClN4O2/c18-14-8-21-15(22-17(19)20)13-7-10(4-5-12(13)14)9-2-1-3-11(6-9)16(23)24/h1-8H,(H,23,24)(H4,19,20,21,22)

InChI key: InChIKey=UXNWIRHZMHGOCE-UHFFFAOYSA-N

SMILES: N(C(=N)N)C=1C2=C(C=CC(=C2)C3=CC(C(O)=O)=CC=C3)C(Cl)=CN1

Synonyms:

• Benzoic acid, 3-[1-[(aminoiminomethyl)amino]-4-chloro-7-isoquinolinyl]-
• [7-(3-Carboxyphenyl)-4-chloroisoquinolin-1-yl)]guanidine
• 3-[1-[(Aminoiminomethyl)amino]-4-chloro-7-isoquinolinyl]benzoic acid
• UK 356202

UK-356202

CAS: 223671-94-1

UK-356,202: potent, selective inhibitor of urokinase-type plasminogen activator (Ki=37 nM), target for breast/ovarian/pancreatic cancer therapy.

Formula: C₁₇H₁₃ClN₄O₂

Color and Shape: Solid

Molecular weight: 340.76

Ref: TM-T69751