CAS 223690-44-6: 5,8-difluoro-4-hydroxyquinoline-3-carboxylic acid

Description: 5,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid is a chemical compound characterized by its quinoline structure, which features a hydroxyl group and a carboxylic acid functional group. The presence of two fluorine atoms at the 5 and 8 positions of the quinoline ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl and carboxylic acid groups. Its unique structure makes it of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, such as antimicrobial or anti-inflammatory agents. The compound's reactivity can be attributed to the functional groups present, allowing for various chemical modifications. Additionally, its fluorinated nature may enhance metabolic stability and bioavailability in drug development. As with many quinoline derivatives, it may also exhibit fluorescence, making it useful in analytical applications. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₀H₅F₂NO₃

InChI: InChI=1/C10H5F2NO3/c11-5-1-2-6(12)8-7(5)9(14)4(3-13-8)10(15)16/h1-3H,(H,13,14)(H,15,16)

Synonyms:

• 3-Quinolinecarboxylic Acid, 5,8-Difluoro-4-Hydroxy-

5,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid

CAS: 223690-44-6

• Molecular weight: 225.15g/mol

5,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid

CAS: 223690-44-6

Versatile small molecule scaffold

• Formula: C₁₀H₅F₂NO₃
• Purity: Min. 95%
• Molecular weight: 225.15 g/mol