CymitQuimica logo

CAS 22371-68-2

:

7-Nitro-6H-dibenzo[b,d]pyran-6-one

Description:
7-Nitro-6H-dibenzo[b,d]pyran-6-one, identified by its CAS number 22371-68-2, is a chemical compound that belongs to the class of dibenzopyran derivatives. This substance features a fused bicyclic structure, characterized by a pyran ring and two benzene rings. The presence of a nitro group at the 7-position contributes to its chemical reactivity and potential applications in various fields, including organic synthesis and medicinal chemistry. The compound is typically a yellow crystalline solid, exhibiting moderate solubility in organic solvents. Its unique structure allows for interesting photophysical properties, making it a subject of study in the development of fluorescent probes and dyes. Additionally, the nitro group can participate in various chemical reactions, enhancing its utility in synthetic pathways. Safety data should be consulted for handling, as nitro compounds can pose risks depending on their specific properties and reactivity. Overall, 7-Nitro-6H-dibenzo[b,d]pyran-6-one is a notable compound with diverse applications in research and industry.
Formula:C13H7NO4
InChI:InChI=1S/C13H7NO4/c15-13-12-9(5-3-6-10(12)14(16)17)8-4-1-2-7-11(8)18-13/h1-7H
InChI key:InChIKey=RRBHCIXYRBIXMK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C=3C(OC2=O)=CC=CC3)=CC=C1
Synonyms:
  • 22371-68-2
  • 6H-Dibenzo[b,d]pyran-6-one, 7-nitro-
  • 7-Nitro-3,4-benzocoumarin
  • 7-Nitro-6H-dibenzo[b,d]pyran-6-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.