CAS 22373-09-7
:D-Arabinonic acid, calcium salt (2:1)
Description:
D-Arabinonic acid, calcium salt (2:1) is a calcium salt derived from D-arabinonic acid, a sugar acid that is a product of the oxidation of D-arabinose. This compound typically appears as a white to off-white powder and is soluble in water, which facilitates its use in various applications. The calcium salt form indicates that it contains two calcium ions for every molecule of D-arabinonic acid, contributing to its stability and solubility characteristics. D-Arabinonic acid itself is known for its role in carbohydrate metabolism and may exhibit antioxidant properties. The calcium salt form is often utilized in food and pharmaceutical industries, where it can serve as a dietary supplement or a food additive. Its safety profile is generally favorable, but specific regulatory guidelines should be followed for its use in food products. Overall, D-arabinonic acid, calcium salt (2:1) is valued for its functional properties and potential health benefits, making it a compound of interest in both nutritional and biochemical research.
Formula:C5H10O6Ca
InChI:InChI=1S/C5H10O6.Ca/c6-1-2(7)3(8)4(9)5(10)11;/h2-4,6-9H,1H2,(H,10,11);/t2-,3-,4+;/m1./s1
InChI key:InChIKey=RMGJOMGLQFWXSQ-PSRPMNHMSA-N
SMILES:[C@H]([C@@H](C(O)=O)O)([C@@H](CO)O)O.[Ca]
Synonyms:- <span class="text-smallcaps">D</span>-Arabinonic acid, calcium salt (2:1)
- Arabinonic acid, calcium salt (2:1), <span class="text-smallcaps">D</span>-
- Calcium D-Arabonate
- NSC 224305
- Pentonic Acid
- calcium bis[(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate] (non-preferred name)
- Arabinonic acid, calcium salt (2:1), D-
- D-Arabinonic acid, calcium salt (2:1)
- Calcium di-D-arabinonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
D-Arabinonic acid, calcium salt (2:1)
CAS:Formula:C5H10CaO6Purity:98%Color and Shape:SolidMolecular weight:206.2073Calcium-D-arabonate
CAS:Calcium-D-arabonate is a fatty acid that is used as a functional ingredient in the food industry. It has been shown to increase the rate of reactions, such as glycosidic bond cleavage and polymerization, by acting as an oxidation catalyst. This product also has a high molecular weight and can be used to modify the structure of polymers. Calcium-D-arabonate is often used in model systems because it reacts with other substances at a pH optimum of 6.0-7.5.
Formula:C5H9O6CaPurity:Min. 98%Color and Shape:White PowderMolecular weight:185.16 g/molCalcium D-Arabinonate
CAS:Controlled ProductApplications Used in the synthesis of D-erythroascorbic acid from D-glucose.
References Gan, L.X., et al.: Carbohydrate Res., 220, 117 (1991),Formula:C10H18CaO12Color and Shape:NeatMolecular weight:370.32



