CAS 2237942-08-2
:rel-[4-Amino-2-[(1R,2R,4S)-bicyclo[2.2.1]hept-2-ylamino]-5-thiazolyl](2-nitrophenyl)methanone
Description:
The chemical substance known as rel-[4-Amino-2-[(1R,2R,4S)-bicyclo[2.2.1]hept-2-ylamino]-5-thiazolyl](2-nitrophenyl)methanone, with the CAS number 2237942-08-2, is a complex organic compound characterized by its unique bicyclic structure and functional groups. It features a thiazole ring, which is known for its biological activity, and an amino group that can participate in various chemical reactions. The presence of a nitrophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The stereochemistry indicated by the rel- prefix and the specific configuration of the bicyclic moiety may influence the compound's biological interactions and pharmacokinetics. This compound's intricate structure may also contribute to its solubility, stability, and reactivity, making it a subject of interest in research focused on drug design and synthesis. Overall, its unique combination of functional groups and stereochemistry positions it as a potentially valuable compound in various chemical and biological applications.
Formula:C17H18N4O3S
InChI:InChI=1/C17H18N4O3S/c18-16-15(14(22)11-3-1-2-4-13(11)21(23)24)25-17(20-16)19-12-8-9-5-6-10(12)7-9/h1-4,9-10,12H,5-8,18H2,(H,19,20)/t9-,10+,12+/s2
InChI key:InChIKey=JRNXAQINDCOHGS-QJUVKGSQNA-N
SMILES:N([C@@H]1[C@@]2(C[C@](C1)(CC2)[H])[H])C=3SC(C(=O)C4=C(N(=O)=O)C=CC=C4)=C(N)N3
Synonyms:- MC 180295
- (rel)-MC 180295
- Methanone, [4-amino-2-[(1R,2R,4S)-bicyclo[2.2.1]hept-2-ylamino]-5-thiazolyl](2-nitrophenyl)-, rel-
- rel-[4-Amino-2-[(1R,2R,4S)-bicyclo[2.2.1]hept-2-ylamino]-5-thiazolyl](2-nitrophenyl)methanone
- MC180295
- MC180295 ((REL)-MC180295)
- MC-180295;MC 180295
- (rel)-MC180295
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
MC180295
CAS:MC180295 ((rel)-MC180295) is a novel potent, highly selective CDK9 inhibitor (IC50: 5 nM), displays >22-fold selectivity over other CDKs.Formula:C17H18N4O3SPurity:99.84%Color and Shape:SolidMolecular weight:358.41Ref: TM-T5533
1mg52.00€5mg124.00€10mg177.00€25mg301.00€50mg424.00€100mg605.00€200mg797.00€1mL*10mM (DMSO)136.00€MC180295
CAS:<p>MC180295 is a bromodomain inhibitor that binds to the CDK4/6-associated bromodomain and inhibits its activity. MC180295 has synergistic effects with venetoclax, which is an inhibitor of Bcl-2. This drug has been shown to be effective against cancer cells in vitro and in vivo, and also sensitizes cancer cells to other drugs. MC180295 is a molecule that suppresses the expression of suppressor genes. It has been shown to be effective at doses of 10 μM or higher in both cell culture and experimental animals.</p>Formula:C17H18N4O3SPurity:Min. 95%Molecular weight:358.41 g/molRef: 3D-MPD94208
Discontinued product



