CymitQuimica logo

CAS 223797-47-5

:

1-Piperazinecarboxylicacid, 4-(3-pyridinyl)-, 1,1-dimethylethyl ester

Description:
1-Piperazinecarboxylic acid, 4-(3-pyridinyl)-, 1,1-dimethylethyl ester, identified by CAS number 223797-47-5, is a chemical compound characterized by its piperazine and pyridine moieties, which contribute to its biological activity and potential pharmacological applications. This compound typically exhibits properties such as moderate solubility in organic solvents and varying solubility in water, influenced by its functional groups. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the ester functional group may enhance lipophilicity, affecting its absorption and distribution in biological systems. The compound's structure allows for potential hydrogen bonding and steric interactions, which can influence its reactivity and binding affinity to specific receptors or enzymes. Overall, this compound's unique structural features position it as a candidate for further research in drug development and therapeutic applications.
Formula:C14H21N3O2
InChI:InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-9-7-16(8-10-17)12-5-4-6-15-11-12/h4-6,11H,7-10H2,1-3H3
InChI key:LZHMIBDVBBRGDF-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)C2=CN=CC=C2
Synonyms:
  • 1,1-Dimethylethyl4-(3-pyridinyl)-1-piperazinecarboxylate
  • 1-(3-Pyridyl)-4-(tert-butoxycarbonyl)piperazine
  • 4-(Pyridin-3-yl)piperazine-1-carboxylic acid tert-butyl ester
  • tert-Butyl4-(pyridin-3-yl)piperazine-1-carboxylate
Found 4 products.