CAS 22383-95-5

3-(2,6-Dimethylphenoxy)propanoic acid

Description:

3-(2,6-Dimethylphenoxy)propanoic acid, with the CAS number 22383-95-5, is an organic compound characterized by its propanoic acid backbone substituted with a 2,6-dimethylphenoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic component. The presence of the carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in acid-base reactions. Additionally, the bulky 2,6-dimethylphenyl group can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with biological systems. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as a chemical intermediate in organic synthesis. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the conditions under which it is studied.

Formula: C₁₁H₁₄O₃

InChI: InChI=1S/C11H14O3/c1-8-4-3-5-9(2)11(8)14-7-6-10(12)13/h3-5H,6-7H2,1-2H3,(H,12,13)

InChI key: InChIKey=YRAOLJXHKFKYKF-UHFFFAOYSA-N

SMILES: O(CCC(O)=O)C1=C(C)C=CC=C1C

Synonyms:

• Propanoic acid, 3-(2,6-dimethylphenoxy)-
• Propionic acid, 3-(2,6-xylyloxy)-
• 3-(2,6-Dimethylphenoxy)propanoic acid

3-(2,6-Dimethylphenoxy)propanoic acid

CAS: 22383-95-5

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-XAA38395