CAS 22387-37-7
:8-methyl-5H-purin-6-amine
Description:
8-Methyl-5H-purin-6-amine, also known as 8-methyladenine, is a purine derivative characterized by its structural features that include a purine ring system with a methyl group at the 8-position and an amino group at the 6-position. This compound is a nucleobase, which plays a role in various biological processes, particularly in the context of nucleic acid metabolism. It is soluble in polar solvents and exhibits basic properties due to the presence of the amino group. The compound is of interest in biochemical research, particularly in studies related to DNA and RNA, as well as in the synthesis of modified nucleotides. Its molecular structure allows for potential interactions with enzymes and other biomolecules, making it relevant in pharmacological and therapeutic contexts. Additionally, 8-methyl-5H-purin-6-amine may exhibit unique properties that could influence its reactivity and stability under different conditions, which is essential for its applications in scientific research and potential drug development.
Formula:C6H7N5
InChI:InChI=1/C6H7N5/c1-3-10-4-5(7)8-2-9-6(4)11-3/h2,4H,1H3,(H2,7,8,9,10,11)
SMILES:CC1=NC2C(=N)N=CN=C2N1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
8-Methyl-7H-purin-6-amine
CAS:Formula:C6H7N5Purity:95.0%Color and Shape:SolidMolecular weight:149.1578-Methyl-7H-purin-6-amine
CAS:<p>8-Methyl-7H-purin-6-amine is a chemical with a molecular weight of 194.2 and a boiling point of 248 °C. It has no color or odor, but it is corrosive in nature. Vapor pressure is 0.0013 mm Hg at 25 °C, acid hydrolysis produces an amide, catalase is unreactive to this compound, and 8-methyl-7H-purin-6-amine does not react with nucleobases under incubated conditions. 8MMP does not form sulfoxide derivatives and is unreactive to alkaline hydrolysis. This compound may be carcinogenic to humans and laboratory studies have shown that benzyl alcohol increases the rate of absorption of 8MMP when ingested orally by rats. Purines are found in RNA and DNA molecules and are essential for life.</p>Formula:C6H7N5Purity:Min. 95%Molecular weight:149.15 g/mol


