CAS 2239-78-3: Propyl palmitate

Description:Propyl palmitate is an ester formed from the reaction of propanol and palmitic acid, a fatty acid. It is characterized by its clear, colorless to pale yellow liquid form and has a mild, fatty odor. With a relatively low viscosity, propyl palmitate is soluble in organic solvents but has limited solubility in water. This compound is primarily used in cosmetic and personal care formulations as an emollient, skin conditioning agent, and solvent due to its ability to impart a smooth feel to products. Additionally, it serves as a carrier for active ingredients in various formulations. Propyl palmitate is considered to be non-toxic and is generally recognized as safe for use in food and cosmetic applications. Its stability under normal conditions makes it suitable for a range of formulations, although it may be sensitive to oxidation. Overall, propyl palmitate is valued for its functional properties in enhancing the texture and performance of various products.

Formula:C₁₉H₃₈O₂

InChI:InChI=1S/C19H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(20)21-18-4-2/h3-18H2,1-2H3

InChI key:InChIKey=BEKZXQKGTDVSKX-UHFFFAOYSA-N

SMILES:O=C(OCCC)CCCCCCCCCCCCCCC