CAS 2239-88-5
:3,3′-Di-O-methylellagic acid
Description:
3,3′-Di-O-methylellagic acid is a naturally occurring polyphenolic compound derived from ellagic acid, which is found in various fruits and vegetables. This compound is characterized by the presence of two methoxy groups (-OCH3) attached to the ellagic acid structure, enhancing its solubility and potentially its bioactivity. It exhibits antioxidant properties, which can help in neutralizing free radicals and may contribute to various health benefits, including anti-inflammatory and anticancer effects. The compound is often studied for its role in plant defense mechanisms and its potential therapeutic applications in human health. Its chemical structure allows for interactions with biological systems, making it a subject of interest in pharmacological research. Additionally, 3,3′-Di-O-methylellagic acid can be analyzed using techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry for its identification and quantification in various matrices. Overall, this compound represents a significant area of study in natural product chemistry and its implications for health and disease prevention.
Formula:C16H10O8
InChI:InChI=1S/C16H10O8/c1-21-11-7(17)3-5-9-10-6(15(19)23-13(9)11)4-8(18)12(22-2)14(10)24-16(5)20/h3-4,17-18H,1-2H3
InChI key:InChIKey=KLAGYIBJNXLDTL-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C3C4=C(C(OC)=C(O)C=C4C(=O)O2)OC(=O)C3=CC1O
Synonyms:- (1)Benzopyrano(5,4,3-cde)(1)benzopyran-5,10-dione, 2,7-dihydroxy-3,8-dimethoxy-
- 2,7-Dihydroxy-3,8-dimethoxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione
- 3,3′-Di-O-methylellagic acid
- 3,3′-Dimethoxyellagic acid
- 3,3′-Dimethylellagic acid
- Diphenic acid, 4,4′,6,6′-tetrahydroxy-5,5′-dimethoxy-, di-δ-lactone
- Ellagic acid 3,3′-dimethyl ether
- Ellagic acid, 3,3′-di-O-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,3'-Di-O-methylellagic acid
CAS:Formula:C16H10O8Purity:98%Color and Shape:SolidMolecular weight:330.24583,3'-Di-O-methylellagic acid
CAS:3,3'-Di-O-methylellagic acid reveals moderate antibacterial activity, it also shows strong DPPH radical scavenging activities with SC50 of 123.3 ug/mL.Formula:C16H10O8Purity:98%Color and Shape:SolidMolecular weight:330.253,3'-Di-O-methylellagic acid
CAS:3,3'-Di-O-methylellagic acid is a natural compound that has been shown to be a potent inhibitor of many enzymes. It inhibits the growth of cancer cells by inhibiting the production of epidermal growth factor and growth factor. This compound also has an inhibitory effect on cyclooxygenase and lipoxygenase, which are enzymes involved in the production of prostaglandins and leukotrienes. 3,3'-Di-O-methylellagic acid has been shown to be effective against chemically induced skin cancers in CD-1 mice and is being investigated for its use as a topical treatment for skin cancer. 3,3'-Di-O-methylellagic acid can be used to detect chromatographic peaks using mass spectrometry.Formula:C16H10O8Purity:Min. 95%Color and Shape:PowderMolecular weight:330.25 g/mol




