CymitQuimica logo

CAS 223916-04-9

:

Isoquinoline,7-bromo-1,2,3,4-tetrahydro-3-(trifluoromethyl)-

Description:
Isoquinoline, 7-bromo-1,2,3,4-tetrahydro-3-(trifluoromethyl)- is a chemical compound that belongs to the isoquinoline family, characterized by a bicyclic structure containing a fused benzene and pyridine ring. The presence of a bromine atom at the 7-position and a trifluoromethyl group at the 3-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features that can interact with biological targets. The trifluoromethyl group enhances lipophilicity and metabolic stability, making it an attractive moiety in drug design. Additionally, the bromine substituent can serve as a site for further chemical modifications, allowing for the synthesis of a variety of derivatives. As with many halogenated compounds, it is essential to handle this substance with care, considering its potential environmental and health impacts.
Formula:C10H9BrF3N
InChI:InChI=1S/C10H9BrF3N/c11-8-2-1-6-4-9(10(12,13)14)15-5-7(6)3-8/h1-3,9,15H,4-5H2
InChI key:PEEKNBLYJJEHJI-UHFFFAOYSA-N
SMILES:C1C(NCC2=C1C=CC(=C2)Br)C(F)(F)F
Synonyms:
  • 7-Bromo-1,2,3,4-Tetrahydro-3-(Trifluoromethyl)-Isoquinoline
Found 0 products.