CymitQuimica logo

CAS 22399-39-9

:

5-Hydroxy-4-methylnaphtho[1,2-b]furan-3(2H)-one

Description:
5-Hydroxy-4-methylnaphtho[1,2-b]furan-3(2H)-one, with the CAS number 22399-39-9, is an organic compound characterized by its complex polycyclic structure, which includes a naphthalene core fused with a furan ring. This compound typically exhibits a range of chemical properties due to the presence of hydroxyl and carbonyl functional groups, which can influence its reactivity and solubility. It is often studied for its potential biological activities, including antioxidant and anti-inflammatory properties, making it of interest in medicinal chemistry and pharmacology. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, affecting its interactions with other molecules. Additionally, the methyl group on the naphthalene ring can influence its electronic properties and steric hindrance. As with many organic compounds, its stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 5-Hydroxy-4-methylnaphtho[1,2-b]furan-3(2H)-one represents a fascinating subject for further research in both synthetic and applied chemistry.
Formula:C13H10O3
InChI:InChI=1S/C13H10O3/c1-7-11-10(14)6-16-13(11)9-5-3-2-4-8(9)12(7)15/h2-5,15H,6H2,1H3
InChI key:InChIKey=MOKOHEFTPWMCDD-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=3C(C1O)=CC=CC3)OCC2=O
Synonyms:
  • 5-Hydroxy-4-methylnaphtho[1,2-b]furan-3(2H)-one
  • Naphtho[1,2-b]furan-3(2H)-one, 5-hydroxy-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.