
CAS 2240-21-3
:Thiofuradene
Description:
Thiofuradene, with the CAS number 2240-21-3, is a chemical compound classified as a thiophene derivative. It is characterized by the presence of sulfur in its ring structure, which contributes to its unique chemical properties. Thiofuradene is primarily recognized for its application in agricultural chemistry, particularly as a pesticide or fungicide. Its molecular structure typically includes a five-membered ring containing both carbon and sulfur atoms, which can influence its reactivity and interaction with biological systems. The compound is known for its potential to inhibit certain enzymatic processes in pests, making it effective in pest management. Additionally, thiofuradene may exhibit varying degrees of solubility in organic solvents, which can affect its formulation and application in agricultural practices. Safety and environmental impact assessments are crucial for its use, as with many agrochemicals, to ensure minimal adverse effects on non-target organisms and ecosystems. Overall, thiofuradene represents a significant compound in the field of agrochemistry, with ongoing research into its efficacy and safety profile.
Formula:C8H8N4O3S
InChI:InChI=1S/C8H8N4O3S/c13-12(14)7-2-1-6(15-7)5-10-11-4-3-9-8(11)16/h1-2,5H,3-4H2,(H,9,16)
InChI key:InChIKey=KXXGBELYAHLJHU-UHFFFAOYSA-N
SMILES:C(=NN1C(=S)NCC1)C=2OC(N(=O)=O)=CC2
Synonyms:- 1-[[(5-Nitro-2-furanyl)methylene]amino]-2-imidazolidinethione
- N-(5-Nitrofurfurylidene)-1-aminoimidazoline-2-thione
- Furidin
- 2-Imidazolidinethione, 1-[(5-nitrofurfurylidene)amino]-
- 2-Imidazolidinethione, 1-[[(5-nitro-2-furanyl)methylene]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thiofuradene
CAS:Thiofuradene is a biochemical.Formula:C8H8N4O3SColor and Shape:SolidMolecular weight:240.24
