CAS 2240-81-5

2,5-anhydro-3,4-dideoxyhexaric acid

Description:

2,5-Anhydro-3,4-dideoxyhexaric acid, with the CAS number 2240-81-5, is a chemical compound characterized by its unique structure, which includes an anhydro sugar framework. This compound is derived from hexaric acids and features two hydroxyl groups that are replaced by hydrogen atoms, resulting in a dideoxy configuration. It is typically a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. The compound exhibits properties typical of carboxylic acids, including the ability to form salts and esters. Its anhydro form suggests that it may participate in various chemical reactions, including esterification and amidation. Additionally, it may have potential applications in biochemistry and pharmaceuticals, particularly in the synthesis of glycosides or as a building block for more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential reactivity.

Formula: C₆H₈O₅

InChI: InChI=1/C6H8O5/c7-5(8)3-1-2-4(11-3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)

SMILES: C1CC(C(=O)O)OC1C(=O)O

Synonyms:

• cis-Tetrahydro-2,5-furandicarboxylic acid
• (2R,5S)-oxolane-2,5-dicarboxylic acid

Tetrahydrofuran-2,5-dicarboxylic Acid

CAS: 2240-81-5

Formula: C₆H₈O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 160.1247

Ref: IN-DA00BFGI

Tetrahydrofuran-2,5-dicarboxylic acid

CAS: 2240-81-5

Tetrahydrofuran-2,5-dicarboxylic acid

Purity: 95%

Molecular weight: 160.12g/mol

Ref: 54-OR1002693

2,5-Anhydro-3,4-dideoxy-erythro-hexaric acid - 98%

CAS: 2240-81-5

The synthesis of 2,5-anhydro-3,4-dideoxy-erythro-hexaric acid (2,5AHDHE) is described in detail. The reaction starts with the condensation of 3,4-dideoxy-erythro-hexose with aldehyde and furfural to give the hemiacetal. The ring opening of this hemiacetal leads to the formation of 2,5AHDHE and furfural. The protonation of 2,5AHDHE leads to proton release and bond cleavage. Furfural is reduced to 5-hydroxymethylfurfural (HMF). HMF is then oxidized to hydroxyl group by H2O2. The hydroxyl group reacts with a second molecule of 2,5AHDHE to form a new molecule of 2,5AHDHE and H2O2. This process can be repeated until

Formula: C₆H₈O₅

Purity: Min. 98 Area-%

Color and Shape: White Powder

Molecular weight: 160.12 g/mol

Ref: 3D-FA164861