CAS 2241-90-9
:(3β,5α,16α,20S)-14-Methyl-3,20-bis(methylamino)-4-methylene-9,19-cyclopregnan-16-ol
Description:
The chemical substance known as "(3β,5α,16α,20S)-14-Methyl-3,20-bis(methylamino)-4-methylene-9,19-cyclopregnan-16-ol," with the CAS number 2241-90-9, is a steroid derivative characterized by its complex structure, which includes a cyclopregnane core. This compound features multiple functional groups, including methylamino groups and a methylene bridge, which contribute to its biological activity. The stereochemistry indicated by the specific configuration at various carbon centers suggests that it may interact with biological systems in a selective manner, potentially influencing hormonal pathways. Steroids like this one are often studied for their pharmacological properties, including potential applications in medicine, such as in hormone replacement therapies or as anabolic agents. Its solubility, stability, and reactivity can vary based on the presence of functional groups and the overall molecular structure, making it a subject of interest in both synthetic and medicinal chemistry. Further research is necessary to fully elucidate its biological effects and potential therapeutic uses.
Formula:C25H42N2O
InChI:InChI=1S/C25H42N2O/c1-15-17-7-8-20-23(4)13-19(28)21(16(2)26-5)22(23,3)11-12-25(20)14-24(17,25)10-9-18(15)27-6/h16-21,26-28H,1,7-14H2,2-6H3/t16-,17-,18-,19+,20-,21-,22+,23-,24+,25-/m0/s1
InChI key:InChIKey=BSNZFQANPMIOIU-WZBMPAQFSA-N
SMILES:C[C@]12[C@]3([C@]4([C@]5(C4)[C@@](CC3)(C(=C)[C@@H](NC)CC5)[H])CC[C@]1(C)[C@@]([C@@H](NC)C)([C@H](O)C2)[H])[H]
Synonyms:- (3beta,5alpha,9beta,16alpha,20S)-14-Methyl-3,20-bis(methylamino)-4-methylene-9,19-cyclopregnan-16-ol
- (3β,5α,16α,20S)-14-Methyl-3,20-bis(methylamino)-4-methylene-9,19-cyclopregnan-16-ol
- 14-Methyl-3b,20a-bis(methylamino)-4-methylene-9,19-cyclo-5a,9b-pregnan-16a-ol
- 1H,19H-Cyclopropa[9,10]cyclopenta[a]phenanthrene, 9,19-cyclopregnan-16-ol deriv.
- 2241-90-9
- 9,19-Cyclo-5α,9β-pregnan-16α-ol, 14-methyl-3β,20α-bis(methylamino)-4-methylene-
- 9,19-Cyclopregnan-16-ol, 14-methyl-3,20-bis(methylamino)-4-methylene-, (3β,5α,16α,20S)-
- Cyclobuxine D
- NSC 91720
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cyclobuxine D
CAS:Cyclobuxine D, from Buxus microphylla, slows rat heart rate and stops rabbit gut muscle contractions.Formula:C25H42N2OPurity:98%Color and Shape:SolidMolecular weight:386.61Cyclobuxine D
CAS:Cyclobuxine D is a steroidal alkaloid, which is a natural bioactive compound derived from the Buxus species, commonly known as the boxwood plant. This compound is produced as a secondary metabolite in these plants and is typically isolated through various chromatographic techniques for scientific investigation. Cyclobuxine D exerts its mode of action by interacting with cellular targets, potentially disrupting cell membrane integrity and interfering with cellular signaling pathways, which leads to its notable cytotoxic effects.Formula:C25H42N2OPurity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:386.61 g/molRef: 4Z-C-237001
Discontinued product


