CAS 22412-97-1: Tetradecyl dodecanoate
Description:Tetradecyl dodecanoate, with the CAS number 22412-97-1, is an ester formed from tetradecanol (a long-chain alcohol) and dodecanoic acid (also known as lauric acid). This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. It is characterized by its hydrophobic nature due to the long hydrocarbon chains, which makes it insoluble in water but soluble in organic solvents. Tetradecyl dodecanoate is often used in cosmetic formulations, as a lubricant, and as an emollient due to its ability to provide a smooth texture and enhance skin feel. Additionally, it may serve as a surfactant or a plasticizer in various industrial applications. The compound exhibits low toxicity and is generally considered safe for use in personal care products. Its stability under normal conditions makes it suitable for various formulations, although it should be stored away from excessive heat and light to maintain its integrity.
Formula:C26H52O2
InChI:InChI=1S/C26H52O2/c1-3-5-7-9-11-13-14-15-17-19-21-23-25-28-26(27)24-22-20-18-16-12-10-8-6-4-2/h3-25H2,1-2H3
InChI key:InChIKey=FNMPODAQERUMDD-UHFFFAOYSA-N
SMILES:O=C(OCCCCCCCCCCCCCC)CCCCCCCCCCC
- Synonyms:
- Dodecanoic acid, tetradecyl ester
- Lauric acid tetradecan-1-yl ester
- Lauric acid, tetradecyl ester
- Myristyl laurate
- Tetradecyl Dodecanoate
- Tetradecyl laurate
- Unii-58U0Nzn2Bt
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Myristyl Laurate REF: 48-45-1214CAS: 22412-97-1 | >99% | 67.00 €~185.00 € | Tue 25 Mar 25 |

Myristyl Laurate
Ref: 48-45-1214
1g | 185.00 € | ||
100mg | 67.00 € |