CAS 22413-04-3: Eicosanoic acid, tetradecyl ester
Description:Eicosanoic acid, tetradecyl ester, also known as tetradecyl eicosanoate, is an ester formed from eicosanoic acid (a long-chain fatty acid) and tetradecanol (a long-chain alcohol). This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. It is characterized by its hydrophobic nature due to the long hydrocarbon chains, which makes it insoluble in water but soluble in organic solvents. Eicosanoic acid, tetradecyl ester is known for its applications in various fields, including cosmetics and pharmaceuticals, where it may serve as an emollient or a lubricant. The compound exhibits low volatility and stability under normal conditions, making it suitable for use in formulations requiring long-lasting effects. Additionally, it may have potential biological activities, although specific studies on its pharmacological properties may be limited. As with many esters, it is important to handle this substance with care, considering potential irritant properties and ensuring proper safety measures during use.
Formula:C34H68O2
InChI:InChI=1S/C34H68O2/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-34(35)36-33-31-29-27-25-23-16-14-12-10-8-6-4-2/h3-33H2,1-2H3
InChI key:InChIKey=XGBICALCKYSGFD-UHFFFAOYSA-N
SMILES:O=C(OCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCCC
- Synonyms:
- Tetradecyl eicosanoate
- Eicosanoic acid, tetradecyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Myristyl Arachidate REF: 48-45-2014CAS: 22413-04-3 | >99% | 67.00 €~201.00 € | Tue 25 Mar 25 |
![]() | Myristyl arachidate REF: 3D-XAA41304CAS: 22413-04-3 | Min. 95% | - - - | Discontinued product |

Myristyl Arachidate
Ref: 48-45-2014
1g | 201.00 € | ||
100mg | 67.00 € |

Myristyl arachidate
Ref: 3D-XAA41304
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |