CAS 22418-67-3

2,3,7-Trimethyl-6-octenal

Description:

2,3,7-Trimethyl-6-octenal is an organic compound classified as an aldehyde, characterized by its long carbon chain and multiple methyl substituents. It features a straight-chain structure with a total of 10 carbon atoms, including a terminal aldehyde functional group. The presence of the double bond in the carbon chain contributes to its reactivity and potential applications in organic synthesis. This compound is typically colorless to pale yellow in appearance and has a distinctive odor, which may be reminiscent of certain natural fragrances. Its molecular structure allows for various interactions, making it useful in the flavor and fragrance industry, as well as in the synthesis of other organic compounds. Additionally, due to its unsaturation, 2,3,7-trimethyl-6-octenal may participate in various chemical reactions, such as oxidation and reduction, which can further modify its properties and applications. Safety data should be consulted for handling and exposure, as with any chemical substance.

Formula: C₁₁H₂₀O

InChI: InChI=1S/C11H20O/c1-9(2)6-5-7-10(3)11(4)8-12/h6,8,10-11H,5,7H2,1-4H3

InChI key: InChIKey=RQJWDOKNRPUUJN-UHFFFAOYSA-N

SMILES: C(CCC=C(C)C)(C(C=O)C)C

Synonyms:

• 2,3,7-Trimethyl-6-octene-al
• 2,3,7-Trimethyl-6-octenal
• 6-Octenal, 2,3,7-trimethyl-