CAS 22419-35-8

4,4-Difluorocyclohexanol

Description:

4,4-Difluorocyclohexanol is an organic compound characterized by the presence of a cyclohexane ring substituted with two fluorine atoms at the 4-position and a hydroxyl group (-OH) also at the 4-position. This compound is a colorless to pale yellow liquid at room temperature and is known for its potential applications in organic synthesis and as a building block in pharmaceuticals. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity and solubility in various solvents. The hydroxyl group contributes to its polarity, making it capable of forming hydrogen bonds, which can affect its boiling point and solubility in water. Additionally, 4,4-Difluorocyclohexanol may exhibit unique properties due to the steric and electronic effects of the fluorine substituents, which can impact its behavior in chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₁₀F₂O

InChI: InChI=1/C6H10F2O/c7-6(8)3-1-5(9)2-4-6/h5,9H,1-4H2

SMILES: C1CC(CCC1O)(F)F

Synonyms:

• 1,1-Difluorocyclohexan-4-ol
• Cyclohexanol, 4,4-Difluoro-

4,4-Difluorocyclohexanol

CAS: 22419-35-8

Formula: C₆H₁₀F₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.1398

Ref: IN-DA0033UT

4,4-Difluorocyclohexanol

CAS: 22419-35-8

Formula: C₆H₁₀F₂O

Purity: >98.0%(GC)

Color and Shape: White to Orange to Green powder to lump

Molecular weight: 136.14

Ref: 3B-D5540

4,4-Difluorocyclohexan-1-ol

CAS: 22419-35-8

4,4-Difluorocyclohexan-1-ol

Formula: C₆H₁₀F₂O

Purity: 95%

Color and Shape: Colourless Liquid

Molecular weight: 136.14g/mol

Ref: 54-PC51054

4,4-Difluorocyclohexanol

CAS: 22419-35-8

Formula: C₆H₁₀F₂O

Purity: 95%

Color and Shape: Solid, Crystalline

Molecular weight: 136.142

Ref: 10-F077852