CAS 2242-96-8

2-(1H-benzimidazol-2-yl)ethanethiol

Description:

2-(1H-benzimidazol-2-yl)ethanethiol, with the CAS number 2242-96-8, is an organic compound characterized by the presence of a benzimidazole moiety and a thiol functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It features a sulfur atom bonded to a two-carbon ethyl chain, which is further connected to a benzimidazole ring, a bicyclic structure known for its aromatic properties and nitrogen heteroatoms. The thiol group (-SH) imparts notable reactivity, allowing for potential applications in various chemical reactions, including nucleophilic substitutions and the formation of disulfides. Additionally, the benzimidazole component contributes to its biological activity, making it of interest in medicinal chemistry for potential therapeutic applications. The compound is generally soluble in polar solvents, and its properties can be influenced by factors such as pH and the presence of other functional groups. Safety data should be consulted for handling, as thiols can be malodorous and may pose health risks.

Formula: C₉H₁₀N₂S

InChI: InChI=1/C9H10N2S/c12-6-5-9-10-7-3-1-2-4-8(7)11-9/h1-4,12H,5-6H2,(H,10,11)

SMILES: c1ccc2c(c1)nc(CCS)[nH]2

Synonyms:

• 1H-benzimidazole-2-ethanethiol
• 2-(1H-Benzimidazol-2-yl)ethanethiol

2-(1H-benzimidazol-2-yl)ethanethiol

CAS: 2242-96-8

Formula: C₉H₁₀N₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 178.25

Ref: 10-F496329