CymitQuimica logo

CAS 22426-14-8

:

2-Bromo-1,10-phenanthroline

Description:
2-Bromo-1,10-phenanthroline is an organic compound characterized by its structure, which consists of a phenanthroline backbone with a bromine substituent at the 2-position. This compound is typically a solid at room temperature and is known for its potential applications in coordination chemistry and as a ligand in metal complexes. The presence of the bromine atom enhances its reactivity and can influence its electronic properties, making it useful in various chemical reactions. 2-Bromo-1,10-phenanthroline exhibits good solubility in organic solvents, which facilitates its use in synthetic processes. Additionally, it may display interesting photophysical properties, such as fluorescence, depending on the metal complexes it forms. The compound is also of interest in biological studies, particularly in the context of its interactions with nucleic acids and potential antitumor activity. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C12H7BrN2
InChI:InChI=1S/C12H7BrN2/c13-10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10/h1-7H
InChI key:InChIKey=ZRJUDAZGVGIDLP-UHFFFAOYSA-N
SMILES:BrC1=NC2=C3C(=CC=C2C=C1)C=CC=N3
Synonyms:
  • 2-Bromo-1,10-phenanthroline
  • 1,10-Phenanthroline, 2-bromo-
  • 2-Bromophenanthroline
Found 6 products.