
CAS 22428-83-7
:piro[2.5]octan-6-ol
Description:
Piro[2.5]octan-6-ol, with the CAS number 22428-83-7, is a chemical compound characterized by its unique bicyclic structure, which includes a piro[2.5]octane framework. This compound features a hydroxyl (-OH) group at the 6-position, contributing to its classification as an alcohol. The presence of the hydroxyl group imparts polar characteristics, enhancing its solubility in polar solvents and influencing its reactivity. Piro[2.5]octan-6-ol may exhibit interesting biological properties, making it of interest in various fields, including medicinal chemistry and materials science. Its structural features may also allow for potential applications in the synthesis of more complex organic molecules. As with many organic compounds, its physical properties, such as boiling point, melting point, and density, would depend on the specific molecular interactions and the presence of functional groups. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C8H14O
InChI:InChI=1S/C8H14O/c9-7-1-3-8(4-2-7)5-6-8/h7,9H,1-6H2
InChI key:JGNHJDIXNUPEFZ-UHFFFAOYSA-N
SMILES:C1CC2(CCC1O)CC2
Synonyms:- piro[2.5]octan-6-ol
- 6-hydroxyspiro[2.5]octane
- Spiro[2.5]octan-6-ol
- SPIRO[2. 5]0CTAN-6-0L
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Spiro[2.5]octan-6-ol
CAS:Spiro[2.5]octan-6-olFormula:C8H14OPurity:≥95%Color and Shape:SolidMolecular weight:126.19616Spiro[2.5]octan-6-ol
CAS:Controlled ProductFormula:C8H14OColor and Shape:NeatMolecular weight:126.196Spiro[2.5]octan-6-ol
CAS:Spiro[2.5]octan-6-ol is a substrate for the enzyme spiroketal synthase. The enzyme binds to its substrate at one of two active sites and converts it into a spiroketal product. Spiro[2.5]octan-6-ol is converted by the enzyme in an ATP-dependent reaction that requires proton transfer and conformational changes in the enzyme, as shown by magnetic resonance spectroscopy measurements. The enzyme also catalyzes the reverse reaction, converting the spiroketal product back into the original substrate. The reaction mechanism involves a proton transfer between water and an amino acid residue in the active site of the enzyme, followed by nucleophilic attack on an adjacent carbonyl group of the substrate. This results in formation of a tetrahedral intermediate which then collapses to form either products or reactant depending on whether it was formed from reactant or product respectively.Formula:C8H14OPurity:Min. 95%Molecular weight:126.2 g/mol





