CAS 22428-91-7: 2-methyl-3-oxobutanal

Description:2-Methyl-3-oxobutanal, also known as 2-methyl-3-oxobutyraldehyde, is an organic compound characterized by its aldehyde functional group and a ketone group, making it a β-dicarbonyl compound. It has a molecular formula that reflects its structure, which includes a five-carbon chain with a methyl group and a ketone located at the third carbon. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in water and organic solvents, which is common for small aldehydes and ketones. 2-Methyl-3-oxobutanal is known for its reactivity, particularly in condensation reactions, and can participate in various organic synthesis processes, including the formation of more complex molecules. Its presence in biochemical pathways may also be of interest, as it can serve as an intermediate in the synthesis of other compounds. Safety data indicates that, like many aldehydes, it should be handled with care due to potential irritant properties.

Formula:C₅H₈O₂

InChI:InChI=1/C5H8O2/c1-4(3-6)5(2)7/h3-4H,1-2H3