CAS 2243-81-4
:1-Naphthalenecarboxamide
Description:
1-Naphthalenecarboxamide, with the CAS number 2243-81-4, is an organic compound characterized by a naphthalene ring structure substituted with a carboxamide group. This compound typically appears as a white to off-white solid and is known for its aromatic properties due to the presence of the naphthalene moiety. It is relatively stable under standard conditions and exhibits moderate solubility in organic solvents, while being less soluble in water. The presence of the carboxamide functional group imparts polar characteristics, influencing its reactivity and interactions with other molecules. 1-Naphthalenecarboxamide can participate in various chemical reactions, including hydrogen bonding and nucleophilic substitutions, making it useful in synthetic organic chemistry. Additionally, it may exhibit biological activity, which has led to its investigation in pharmaceutical research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 1-naphthalenecarboxamide serves as an important compound in both industrial applications and research contexts.
Formula:C11H9NO
InChI:InChI=1S/C11H9NO/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,12,13)
InChI key:InChIKey=RMHJJUOPOWPRBP-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- 1-Naphthalenecarboxylic acid amide
- 1-Naphthamide
- 1-Naphthylamide
- NSC 38871
- Naphthalene-1-carboxamide
- Naphthylacetamide
- 1-Naphthalenecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
alpha-Naphthamide
CAS:Alpha-naphthamide is a high-resistance antimicrobial agent that belongs to the group of benzalkonium chloride. It is used in disinfectant products and has been shown to be effective against invertebrates such as mosquitoes and leeches. Alpha-naphthamide binds to the dinucleotide phosphate and inhibits enzyme activities by acting as an alkylsulfonyl and cytosolic Ca2+ inhibitor, leading to cell death. Alpha-naphthamide has also been shown to inhibit multidrug efflux pump activity in bacterial cells, which may be due to its structural similarity with c1-c6.Formula:C11H9NOPurity:Min. 95%Color and Shape:SolidMolecular weight:171.2 g/mol1-Naphthamide
CAS:Controlled ProductApplications 1-Naphthamide (cas# 2243-81-4) is a useful research chemical.
Formula:C11H9NOColor and Shape:NeatMolecular weight:171.2





