CymitQuimica logo

CAS 2243-89-2

:

2,4,6-Trimethylquinoline

Description:
2,4,6-Trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. Its molecular formula is C12H13N, indicating the presence of 12 carbon atoms, 13 hydrogen atoms, and one nitrogen atom. This compound is typically a yellowish liquid with a distinctive aromatic odor. It is known for its relatively high boiling point and moderate solubility in organic solvents, while being less soluble in water. 2,4,6-Trimethylquinoline exhibits properties typical of nitrogen-containing heterocycles, including potential applications in the synthesis of dyes, pharmaceuticals, and agrochemicals. Additionally, it may serve as a building block in organic synthesis due to its reactivity and ability to undergo various chemical transformations. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2,4,6-trimethylquinoline is a compound of interest in both industrial and research settings due to its unique structural features and chemical properties.
Formula:C12H13N
InChI:InChI=1S/C12H13N/c1-8-4-5-12-11(6-8)9(2)7-10(3)13-12/h4-7H,1-3H3
InChI key:InChIKey=ZXGXGZGKWSUMJK-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(C)C1)C=CC(C)=C2
Synonyms:
  • 4,6-Dimethylquinaldine
  • Quinoline, 2,4,6-trimethyl-
  • 2,4,6-Trimethylquinoline
Found 2 products.