CAS 22430-23-5
:L-mannonic gamma-lactone
Description:
L-mannonic gamma-lactone, with the CAS number 22430-23-5, is a cyclic ester derived from L-mannonic acid. It is characterized by its lactone structure, which is formed through the intramolecular esterification of the carboxylic acid group of L-mannonic acid. This compound typically appears as a white to off-white solid and is soluble in water due to its polar functional groups. L-mannonic gamma-lactone is known for its role in carbohydrate chemistry and may exhibit biological activity, potentially influencing metabolic pathways. Its molecular structure includes a six-membered ring, contributing to its stability and reactivity. The compound can participate in various chemical reactions, including hydrolysis and esterification, making it of interest in synthetic organic chemistry and biochemistry. Additionally, it may serve as an intermediate in the synthesis of other bioactive compounds or as a building block in carbohydrate derivatives. Overall, L-mannonic gamma-lactone is a significant compound in both research and potential applications in pharmaceuticals and food chemistry.
Formula:C6H10O6
InChI:InChI=1/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2?,3?,4-,5+/m1/s1
Synonyms:- L-mannonic acid gamma-lactone
- L-Mannono-1,4-lactone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Mannonic acid-1,4-lactone
CAS:Formula:C6H10O6Purity:≥ 97.0%Color and Shape:White powderMolecular weight:178.14L-Mannonic acid-1,4-lactone
CAS:L-Mannonic acid-1,4-lactone is an acidic compound that has kinetic properties. It is used in the assays of chloride ions and neutral pH. L-Mannonic acid-1,4-lactone also has conjugates with hydrolytic activity and can be used as a synthetic intermediate for other organic compounds. L-Mannonic acid-1,4-lactone can be found in group P2 of the periodic table because it contains a hydroxyl group and an organic group with a methyl ethyl side chain. L-Mannonic acid-1,4-lactone hydrolyzes at high temperatures and may exhibit synergistic effects when combined with other agents. This product is also used to incubate cells such as k562 cells.
Formula:C6H10O6Purity:Min. 95%Color and Shape:PowderMolecular weight:178.14 g/mol(3R,4S,5S)-5-((S)-1,2-dihydroxyethyl)-3,4-dihydroxydihydrofuran-2(3H)-one
CAS:Purity:98%Molecular weight:178.05L-Mannono-1,4-Lactone
CAS:Controlled ProductApplications L-Mannono-1,4-lactone (cas# 22430-23-5) is a compound useful in organic synthesis.
Formula:C6H10O6Color and Shape:NeatMolecular weight:178.14




