CAS 22430-27-9
:L-Ascorbic acid, 3-(hydrogen sulfate)
Description:
L-Ascorbic acid, 3-(hydrogen sulfate), also known as ascorbic acid sulfate, is a derivative of vitamin C, which is essential for various biological functions. This compound features a sulfate group attached to the ascorbic acid structure, influencing its solubility and reactivity. It is typically a white to off-white crystalline powder, highly soluble in water, which enhances its bioavailability. The presence of the sulfate group can affect its stability and interaction with other compounds. L-Ascorbic acid itself is known for its antioxidant properties, playing a crucial role in collagen synthesis, immune function, and the absorption of iron from plant-based foods. The chemical formula reflects its molecular structure, which includes multiple hydroxyl groups contributing to its reactivity and ability to donate electrons. As a sulfate derivative, it may exhibit different pharmacokinetic properties compared to its parent compound, potentially influencing its therapeutic applications. Overall, L-Ascorbic acid, 3-(hydrogen sulfate) is significant in both nutritional and pharmaceutical contexts, warranting further study for its potential benefits and applications.
Formula:C6H8O9S
InChI:InChI=1S/C6H8O9S/c7-1-2(8)4-5(15-16(11,12)13)3(9)6(10)14-4/h2,4,7-9H,1H2,(H,11,12,13)/t2-,4+/m0/s1
InChI key:InChIKey=FBFZPSQPKNIVMT-ZAFYKAAXSA-N
SMILES:[C@@H](CO)(O)[C@@]1(C(OS(=O)(=O)O)=C(O)C(=O)O1)[H]
Synonyms:- L-Ascorbic acid 3-sulfate
- L-Ascorbic acid, 3-(hydrogen sulfate)
- L-Ascorbic acid-3-sulfuric acid ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
L-Ascorbic Acid 3-Sulfate
CAS:Controlled ProductFormula:C6H8O9SColor and Shape:NeatMolecular weight:256.187L-Ascorbic Acid 3-Sulfate-13C6
CAS:Controlled ProductFormula:C6H8O9SColor and Shape:NeatMolecular weight:262.143
