CymitQuimica logo

CAS 22430-64-4

:

4,6-Dimethyl-1H-indene

Description:
4,6-Dimethyl-1H-indene is an organic compound characterized by its bicyclic structure, which consists of a fused benzene and cyclopentene ring. This compound features two methyl groups attached to the indene framework at the 4 and 6 positions, contributing to its unique chemical properties. It is a colorless to pale yellow liquid at room temperature and is known for its aromatic characteristics. The presence of the indene structure imparts reactivity typical of alkenes, making it susceptible to electrophilic addition reactions. Additionally, 4,6-Dimethyl-1H-indene can participate in various chemical transformations, including polymerization and oxidation. Its applications may extend to the synthesis of more complex organic molecules and materials in the field of organic chemistry. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if inhaled or ingested. Overall, 4,6-Dimethyl-1H-indene is a notable compound in synthetic organic chemistry due to its structural features and reactivity.
Formula:C11H12
InChI:InChI=1S/C11H12/c1-8-6-9(2)11-5-3-4-10(11)7-8/h3,5-7H,4H2,1-2H3
InChI key:InChIKey=KIEPLAOSYPLFEI-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC(C)=C1)CC=C2
Synonyms:
  • 4,6-Dimethylindene
  • Indene, 4,6-dimethyl-
  • 4,6-Dimethyl-1H-indene
  • 1H-Indene, 4,6-dimethyl-
Found 4 products.