CAS 22431-46-5
:(2R)-N-[2-chloro-1-[(3R,4R,6R)-3,4,5-trihydroxy-6-methylsulfinyl-tetrahydropyran-2-yl]propyl]-1-methyl-4-propyl-pyrrolidine-2-carboxamide hydrochloride
Description:
The chemical substance known as (2R)-N-[2-chloro-1-[(3R,4R,6R)-3,4,5-trihydroxy-6-methylsulfinyl-tetrahydropyran-2-yl]propyl]-1-methyl-4-propyl-pyrrolidine-2-carboxamide hydrochloride, with the CAS number 22431-46-5, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which contributes to its cyclic structure, and includes a carboxamide functional group that enhances its solubility and reactivity. The presence of a chloro substituent and a sulfinyl group indicates potential biological activity, possibly influencing its pharmacological properties. The multiple hydroxyl groups suggest that the compound may engage in hydrogen bonding, affecting its interactions with biological targets. This compound is likely to be soluble in polar solvents due to its hydrophilic characteristics. Its specific stereochemistry may play a crucial role in its biological activity, making it of interest in medicinal chemistry and drug development. Overall, this compound's unique structure and functional groups position it as a candidate for further investigation in therapeutic applications.
Formula:C18H34Cl2N2O6S
InChI:InChI=1/C18H33ClN2O6S.ClH/c1-5-6-10-7-11(21(3)8-10)17(25)20-12(9(2)19)16-14(23)13(22)15(24)18(27-16)28(4)26;/h9-16,18,22-24H,5-8H2,1-4H3,(H,20,25);1H/t9?,10?,11-,12?,13-,14-,15?,16?,18-,28?;/m1./s1
SMILES:CCCC1C[C@H](C(=NC(C(C)Cl)C2[C@@H]([C@H](C([C@H](O2)S(=O)C)O)O)O)O)N(C)C1.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Clindamycin Sulfoxide
CAS:Clindamycin sulfoxide, an active clindamycin metabolite formed by CYP3A4, inhibits P. prevotti, B. fragilis, C. sordelli with MICs 2, 2, 1 mg/L.Formula:C18H33ClN2O6SColor and Shape:SolidMolecular weight:440.98Clindamycin Sulfoxide-13C-d3 (Mixture of Diastereomers)
CAS:Formula:C1713CH30D3ClN2O6SMolecular weight:444.99Clindamycin Sulfoxide
CAS:Formula:C18H33ClN2O6SColor and Shape:White To Off-White SolidMolecular weight:440.98Clindamycin Sulfoxide (Mixture of Diastereomers)
CAS:Controlled ProductFormula:C18H33ClN2O6SColor and Shape:WhiteMolecular weight:440.98Clindamycin-13C,D3 Sulfoxide
CAS:Controlled ProductFormula:C17CH30D3ClN2O6SColor and Shape:NeatMolecular weight:444.99Clindamycin sulfoxide
CAS:Clindamycin sulfoxide is a potent metabolite of the lincosamide antibiotic clindamycin, which is derived from the fermentation product of *Streptomyces lincolnensis*. This compound acts by inhibiting bacterial protein synthesis through binding to the 50S ribosomal subunit, thereby interfering with the translocation steps in protein elongation. The mechanism effectively suppresses the growth of a broad range of Gram-positive bacteria, including *Staphylococcus aureus*, *Streptococcus pneumoniae*, and anaerobic microorganisms.Formula:C18H33ClN2O6SPurity:Min. 95%Molecular weight:440.98 g/mol




