CAS 22432-80-0: Eicosyl eicosanoate
Description:Eicosyl eicosanoate, with the CAS number 22432-80-0, is an ester formed from the reaction of eicosanol (a long-chain fatty alcohol) and eicosanoic acid (a long-chain fatty acid). This compound is characterized by its long hydrocarbon chains, which typically impart hydrophobic properties, making it insoluble in water but soluble in organic solvents. Eicosyl eicosanoate is often used in cosmetic formulations and personal care products due to its emollient properties, providing a smooth and moisturizing feel on the skin. Additionally, it can enhance the texture and stability of formulations. The compound is generally stable under normal conditions, but like many esters, it may be susceptible to hydrolysis in the presence of strong acids or bases. Its physical properties, such as melting point and boiling point, are influenced by the length of the carbon chains and the degree of saturation. Overall, eicosyl eicosanoate serves as a versatile ingredient in various applications, particularly in the cosmetic and personal care industries.
Formula:C40H80O2
InChI:InChI=1S/C40H80O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-42-40(41)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-39H2,1-2H3
InChI key:InChIKey=VJFBRZCPEBSUHG-UHFFFAOYSA-N
SMILES:O=C(OCCCCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCCC
- Synonyms:
- 1-Eicosanol, eicosanoate
- Arachidyl arachidate
- Eicosanoic acid, eicosyl ester
- Eicosanyl eicosanoate
- Eicosyl eicosanoate
- Icosyl icosanoate
- n-Eicosyl n-eicosanoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Arachidyl Arachidate REF: 48-45-2020CAS: 22432-80-0 | >99% | 78.00 €~232.00 € | Thu 14 Aug 25 |
![]() | Arachidyl arachidate REF: 3D-XAA43280CAS: 22432-80-0 | Min. 95% | - - - | Discontinued product |

Arachidyl Arachidate
Ref: 48-45-2020
1g | 232.00 € | ||
100mg | 78.00 € |

Arachidyl arachidate
Ref: 3D-XAA43280
5g | Discontinued | Request information |