![(2S)-1-Chloro-3-[(phenylmethylene)amino]-2-propanol](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F562003-s-1-benzylideneamino-3-chloropropan-2-ol.webp&w=3840&q=75)
CAS 224323-52-8
:(2S)-1-Chloro-3-[(phenylmethylene)amino]-2-propanol
Description:
(2S)-1-Chloro-3-[(phenylmethylene)amino]-2-propanol, with the CAS number 224323-52-8, is a chiral organic compound characterized by the presence of a chlorine atom, an amino group, and a phenylmethylene substituent. This compound features a propanol backbone, which contributes to its potential as a chiral building block in organic synthesis. The presence of the chlorine atom introduces reactivity, making it useful in various chemical transformations. The phenylmethylene group enhances its aromatic character, which can influence its interactions in biological systems and its solubility in organic solvents. As a chiral molecule, it may exhibit different properties based on its stereochemistry, which can affect its biological activity and interactions with other molecules. This compound may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can be tailored for specific biological targets. However, detailed studies on its toxicity, stability, and reactivity are essential for understanding its practical applications.
Formula:C10H12ClNO
InChI:InChI=1S/C10H12ClNO/c11-6-10(13)8-12-7-9-4-2-1-3-5-9/h1-5,7,10,13H,6,8H2/t10-/m1/s1
InChI key:InChIKey=PHFWZIAEQLVDMM-SNVBAGLBSA-N
SMILES:C(=NC[C@@H](CCl)O)C1=CC=CC=C1
Synonyms:- (2S)-1-Chloro-3-[(phenylmethylene)amino]-2-propanol
- (S)-1-(Benzylideneamino)-3-chloropropan-2-ol
- 2-Propanol, 1-chloro-3-[(phenylmethylene)amino]-, (2S)-
- Linezolid Impurity 134
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
