CAS 22433-91-6
:2-Bromo-1,3-benzenedicarboxylic acid
Description:
2-Bromo-1,3-benzenedicarboxylic acid, with the CAS number 22433-91-6, is an aromatic compound characterized by the presence of two carboxylic acid groups (-COOH) and a bromine atom attached to a benzene ring. This compound features a symmetrical structure where the bromine substituent is located at the 2-position relative to one of the carboxylic acid groups, while the other carboxylic acid group is positioned at the 1 and 3 positions on the benzene ring. The presence of the bromine atom enhances the compound's reactivity, making it useful in various chemical syntheses and applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid groups. The compound can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in organic synthesis and materials science. Additionally, its derivatives may have potential applications in pharmaceuticals and agrochemicals, owing to the biological activity often associated with brominated aromatic compounds.
Formula:C8H5BrO4
InChI:InChI=1S/C8H5BrO4/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=LOICBODWTPYJIW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C(C(O)=O)=CC=C1
Synonyms:- 1,3-Benzenedicarboxylic acid, 2-bromo-
- 2-Bromo-1,3-benzenedicarboxylic acid
- 2-Bromoisophthalic acid
- Isophthalic acid, 2-bromo-
- NSC 312822
- NSC 312849
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-bromobenzene-1,3-dicarboxylic acid
CAS:Formula:C8H5BrO4Purity:98%Color and Shape:SolidMolecular weight:245.02692-Bromobenzene-1,3-dicarboxylic acid
CAS:2-Bromobenzene-1,3-dicarboxylic acid is a carboxylic acid that belongs to the class of aromatic hydrocarbons. It is used in the synthesis of biphenyls and has been found to be an inhibitor of serine proteases. 2-Bromobenzene-1,3-dicarboxylic acid has been shown to be a substrate for oxytocin receptors with hydrogen bonding interactions. This compound also has antireflection properties and can be functionalized by conjugation with other molecules containing functional groups (e.g., biphenyl). 2-Bromobenzene-1,3-dicarboxylic acid can also react with palladium complexes to form aryl chlorides.
Formula:C8H5BrO4Purity:Min. 95%Molecular weight:245.03 g/mol




