
CAS 2244035-16-1
:3-[6-[1-(2-Chloro-6-cyclopropylphenyl)ethoxy]-4-cyclopropyl-3-quinolinyl]-2-propenoic acid
Description:
3-[6-[1-(2-Chloro-6-cyclopropylphenyl)ethoxy]-4-cyclopropyl-3-quinolinyl]-2-propenoic acid is a complex organic compound characterized by its unique structural features, including a quinoline core and multiple cyclopropyl groups. This compound likely exhibits properties typical of quinoline derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the quinoline moiety, which is known for its pharmacological significance. The presence of the chloro and cyclopropyl substituents may influence its lipophilicity and reactivity, potentially enhancing its interaction with biological targets. Additionally, the propenoic acid functional group suggests the potential for further chemical reactivity, such as polymerization or conjugation reactions. The compound's molecular weight, solubility, and stability would depend on its specific structural attributes and the environment in which it is studied. Overall, this substance represents a class of compounds that may be of interest in medicinal chemistry and drug development.
Formula:C26H24ClNO3
InChI:InChI=1/C26H24ClNO3/c1-15(25-20(16-5-6-16)3-2-4-22(25)27)31-19-10-11-23-21(13-19)26(17-7-8-17)18(14-28-23)9-12-24(29)30/h2-4,9-17H,5-8H2,1H3,(H,29,30)/b12-9+
InChI key:InChIKey=HOMQCLNBKVHZGD-FMIVXFBMNA-N
SMILES:C(=C/C(O)=O)\C1=C(C2=C(N=C1)C=CC(OC(C)C3=C(C=CC=C3Cl)C4CC4)=C2)C5CC5
Synonyms:- G 907
- 3-[6-[1-(2-Chloro-6-cyclopropylphenyl)ethoxy]-4-cyclopropyl-3-quinolinyl]-2-propenoic acid
- 2-Propenoic acid, 3-[6-[1-(2-chloro-6-cyclopropylphenyl)ethoxy]-4-cyclopropyl-3-quinolinyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
G907
CAS:G907 is an antagonist of the ATP-binding cassette (ABC) transporter protein MsbA with bactericidal activity. G907 inhibits MsbA in E. coli.Formula:C26H24ClNO3Purity:98.06% - 98.14%Color and Shape:SolidMolecular weight:433.93G907
CAS:G907 is an anticancer drug that targets specific proteins involved in cell cycle regulation and tumor growth. It acts as a potent kinase inhibitor, blocking the activity of enzymes that promote cancer cell proliferation. G907 has been shown to be effective against various types of cancers including leukemia and solid tumors. This medicinal compound is derived from Chinese herbal medicine and has shown promising results in inducing apoptosis, or programmed cell death, in cancer cells. G907 is excreted through urine and has minimal side effects compared to traditional chemotherapy drugs. Its unique mechanism of action makes it a promising candidate for future cancer therapies.Formula:C26H24ClNO3Purity:Min. 95%Molecular weight:433.9 g/mol


