CAS 22441-21-0

Bis(2,3,4,5,6-pentachlorophenyl) disulfide

Description:

Bis(2,3,4,5,6-pentachlorophenyl) disulfide, with the CAS number 22441-21-0, is an organosulfur compound characterized by its complex structure featuring two pentachlorophenyl groups linked by a disulfide bond. This compound is notable for its high degree of chlorination, which contributes to its stability and lipophilicity, making it persistent in the environment. It is typically a solid at room temperature and may exhibit low solubility in water but higher solubility in organic solvents. The presence of multiple chlorine atoms enhances its potential for bioaccumulation and toxicity in aquatic organisms. Bis(2,3,4,5,6-pentachlorophenyl) disulfide is often studied for its environmental impact, particularly in relation to its role as a pollutant and its effects on ecosystems. Additionally, due to its chemical structure, it may exhibit specific reactivity patterns, making it of interest in various chemical synthesis applications. Safety precautions are essential when handling this compound due to its potential health hazards.

Formula: C₁₂Cl₁₀S₂

InChI: InChI=1S/C12Cl10S2/c13-1-3(15)7(19)11(8(20)4(1)16)23-24-12-9(21)5(17)2(14)6(18)10(12)22

InChI key: InChIKey=LSVXAQMPXJUTBV-UHFFFAOYSA-N

SMILES: S(SC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl)C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl

Synonyms:

• 1,1'-Disulfanediylbis(pentachlorobenzene)
• 244-999-3
• Bis(2,3,4,5,6-pentachlorophenyl) disulfide
• Disulfide, Bis(2,3,4,5,6-Pentachlorophenyl)
• Disulfide, bis(pentachlorophenyl)
• Perchlorodiphenyl disulfide
• Bis(pentachlorophenyl) disulfide