CAS 22446-12-4

4-Methoxyphenoxyacetonitrile

Description:

4-Methoxyphenoxyacetonitrile, with the CAS number 22446-12-4, is an organic compound characterized by its functional groups, which include a methoxy group and a nitrile group. It features a phenoxyacetic acid structure, where the phenoxy moiety is substituted with a methoxy group at the para position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the nitrile group contributes to its reactivity, allowing for further chemical transformations. Additionally, 4-Methoxyphenoxyacetonitrile may exhibit moderate solubility in organic solvents, while its solubility in water is generally low due to its hydrophobic characteristics. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest in both research and industrial applications due to its versatile chemical properties.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c1-11-8-2-4-9(5-3-8)12-7-6-10/h2-5H,7H2,1H3

SMILES: COc1ccc(cc1)OCC#N

4-Methoxyphenoxyacetonitrile

CAS: 22446-12-4

Formula: C₉H₉NO₂

Purity: 98%

Molecular weight: 163.1733

Ref: IN-DA003LO6

2-(4-Methoxyphenoxy)acetonitrile

CAS: 22446-12-4

2-(4-Methoxyphenoxy)acetonitrile

Purity: 95%

Molecular weight: 163.17g/mol

Ref: 54-OR29620

2-(4-Methoxyphenoxy)acetonitrile

CAS: 22446-12-4

2-(4-Methoxyphenoxy)acetonitrile is a chemical compound that is used to synthesize acetobromoglucose. It undergoes transformation and condensation reactions with acetobromoglucose to form 4-methoxyaceto bromoglucose.

Formula: C₉H₉NO₂

Purity: Min. 95%

Molecular weight: 163.17 g/mol

Ref: 3D-FM36029

2-(4-Methoxyphenoxy)acetonitrile

CAS: 22446-12-4

Formula: C₉H₉NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 163.176

Ref: 10-F068149