CAS 22446-43-1

2-Hydroxybenzeneacetic acid hydrazide

Description:

2-Hydroxybenzeneacetic acid hydrazide, also known as salicylhydrazide, is an organic compound characterized by the presence of both a hydrazide functional group and a hydroxyl group attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and ethanol, which facilitates its use in various chemical reactions and applications. The presence of the hydroxyl group contributes to its potential as a chelating agent, allowing it to form complexes with metal ions. Additionally, 2-Hydroxybenzeneacetic acid hydrazide may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with biological systems, which can lead to various therapeutic applications. As with many hydrazides, it is important to handle this compound with care due to potential reactivity and toxicity. Overall, 2-Hydroxybenzeneacetic acid hydrazide is a versatile compound with applications in both organic synthesis and medicinal chemistry.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1S/C8H10N2O2/c9-10-8(12)5-6-3-1-2-4-7(6)11/h1-4,11H,5,9H2,(H,10,12)

InChI key: InChIKey=IHJFPMLYICHHCW-UHFFFAOYSA-N

SMILES: C(C(NN)=O)C1=C(O)C=CC=C1

Synonyms:

• Benzeneacetic acid, 2-hydroxy-, hydrazide
• (2-Hydroxy-phenyl)-acetic acid hydrazide
• Acetic acid, (o-hydroxyphenyl)-, hydrazide
• 2-(2-Hydroxyphenyl)acetohydrazide
• 2-Hydroxybenzeneacetic acid hydrazide

2-(2-Hydroxyphenyl)acetohydrazide

CAS: 22446-43-1

Versatile small molecule scaffold

Formula: C₈H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 166.18 g/mol

Ref: 3D-XAA44643