CAS 2245-38-7: 2,3,5-Trimethylnaphthalene
Description:2,3,5-Trimethylnaphthalene is an organic compound belonging to the naphthalene family, characterized by its polycyclic aromatic structure. It features three methyl groups attached to the naphthalene ring system, specifically at the 2, 3, and 5 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It has a relatively high melting point and boiling point compared to simpler hydrocarbons, reflecting its stable aromatic structure. 2,3,5-Trimethylnaphthalene is insoluble in water but soluble in organic solvents, making it useful in various chemical applications. It is often studied for its role in the synthesis of other organic compounds and as a potential intermediate in the production of dyes, fragrances, and other industrial chemicals. Additionally, due to its aromatic nature, it may exhibit certain toxicological properties, necessitating careful handling and assessment in laboratory and industrial settings. Overall, this compound is of interest in both academic research and industrial applications.
Formula:C13H14
InChI:InChI=1S/C13H14/c1-9-5-4-6-12-7-10(2)11(3)8-13(9)12/h4-8H,1-3H3
InChI key:InChIKey=JBXULKRNHAQMAS-UHFFFAOYSA-N
SMILES:C1=CC2=CC(=C(C=C2C(=C1)C)C)C
- Synonyms:
- 1,6,7-Trimethylnaphthalene
- NSC 89511
- Naphthalene, 1,6,7-trimethyl-
- 2,3,5-Trimethylnaphthalene
